C29H42O7 — CID 100878862
(3aR,5S,6R,6aS)-6-[(4-butoxyphenyl)methoxy]-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 100878862) has the molecular formula C29H42O7 and a molecular weight of 502.65 g/mol. Its IUPAC name is (3aR,5S,6R,6aS)-6-[(4-butoxyphenyl)methoxy]-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aR,5S,6R,6aS)-6-[(4-butoxyphenyl)methoxy]-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 100878862 |
| Molecular Formula | C29H42O7 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (3aR,5S,6R,6aS)-6-[(4-butoxyphenyl)methoxy]-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | CCCCOc1ccc(CO[C@H]2[C@@H]3OC4(CCCCC4)O[C@H]3O[C@H]2[C@@H]2COC3(CCCCC3)O2)cc1 |
| InChI | InChI=1S/C29H42O7/c1-2-3-18-30-22-12-10-21(11-13-22)19-31-25-24(23-20-32-28(34-23)14-6-4-7-15-28)33-27-26(25)35-29(36-27)16-8-5-9-17-29/h10-13,23-27H,2-9,14-20H2,1H3/t23-,24-,25+,26-,27+/m0/s1 |
| InChIKey | JAJFVZGROBYHIY-UIPNDDLNSA-N |
| XLogP | 5.63 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|