C22H32O7 — CID 124832006
(3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(4-propoxyphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 124832006) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is (3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(4-propoxyphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(4-propoxyphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 124832006 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(4-propoxyphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCCOc1ccc(CO[C@H]2[C@@H]3OC(C)(C)O[C@@H]3O[C@H]2[C@@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H32O7/c1-6-11-23-15-9-7-14(8-10-15)12-24-18-17(16-13-25-21(2,3)27-16)26-20-19(18)28-22(4,5)29-20/h7-10,16-20H,6,11-13H2,1-5H3/t16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | DCXWQAUMSHLOLW-KNJMJIDISA-N |
| XLogP | 3.39 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |