C21H30O6 — CID 89381934
[3-(2-adamantyloxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-methylprop-2-enoate (PubChem CID 89381934) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [3-(2-adamantyloxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-adamantyloxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89381934 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [3-(2-adamantyloxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1COC2C(OCOC3C4CC5CC(C4)CC3C5)COC12 |
| InChI | InChI=1S/C21H30O6/c1-11(2)21(22)27-17-9-24-19-16(8-23-20(17)19)25-10-26-18-14-4-12-3-13(6-14)7-15(18)5-12/h12-20H,1,3-10H2,2H3 |
| InChIKey | PVDCEOUMAZFSIM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|