C19H24O9 — CID 144922848
[(3R,4R,5S)-6-acetyloxy-4,5-bis(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate (PubChem CID 144922848) has the molecular formula C19H24O9 and a molecular weight of 396.39 g/mol. Its IUPAC name is [(3R,4R,5S)-6-acetyloxy-4,5-bis(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [(3R,4R,5S)-6-acetyloxy-4,5-bis(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144922848 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [(3R,4R,5S)-6-acetyloxy-4,5-bis(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1[C@H](OC(=O)C(=C)C)C(OC(C)=O)OC[C@H]1OC(=O)C(=C)C |
| InChI | InChI=1S/C19H24O9/c1-9(2)16(21)26-13-8-24-19(25-12(7)20)15(28-18(23)11(5)6)14(13)27-17(22)10(3)4/h13-15,19H,1,3,5,8H2,2,4,6-7H3/t13-,14-,15+,19?/m1/s1 |
| InChIKey | AEZAUWBWOAEGKH-HIPPRFIVSA-N |
| XLogP | 1.37 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|