C20H28N2O10 — CID 90287202
2-[[(3aR,6R,6aR)-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 90287202) has the molecular formula C20H28N2O10 and a molecular weight of 456.45 g/mol. Its IUPAC name is 2-[[(3aR,6R,6aR)-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(3aR,6R,6aR)-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90287202 |
| Molecular Formula | C20H28N2O10 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[[(3aR,6R,6aR)-6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C20H28N2O10/c1-11(2)17(23)27-7-5-21-19(25)31-13-9-29-16-14(10-30-15(13)16)32-20(26)22-6-8-28-18(24)12(3)4/h13-16H,1,3,5-10H2,2,4H3,(H,21,25)(H,22,26)/t13-,14?,15-,16-/m1/s1 |
| InChIKey | UTXAMFWVRNKFBO-QGAIPKOMSA-N |
| XLogP | 0.21 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|