C15H25NO4 — CID 126547486
2-[(4-methylcyclohexyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 126547486) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[(4-methylcyclohexyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(4-methylcyclohexyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126547486 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-[(4-methylcyclohexyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC1CCC(C)CC1 |
| InChI | InChI=1S/C15H25NO4/c1-11(2)14(17)19-9-8-16-15(18)20-10-13-6-4-12(3)5-7-13/h12-13H,1,4-10H2,2-3H3,(H,16,18) |
| InChIKey | QEXAAVQMXGJFJT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|