C21H33N3O7 — CID 14669980
2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]piperidine-1-carbonyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 14669980) has the molecular formula C21H33N3O7 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]piperidine-1-carbonyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]piperidine-1-carbonyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 14669980 |
| Molecular Formula | C21H33N3O7 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]piperidine-1-carbonyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCC1CCCCN1C(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C21H33N3O7/c1-15(2)18(25)29-13-9-22-20(27)24-11-6-5-7-17(24)8-12-31-21(28)23-10-14-30-19(26)16(3)4/h17H,1,3,5-14H2,2,4H3,(H,22,27)(H,23,28) |
| InChIKey | DPHWWOFSEZVBRZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|