C14H24N2O4 — CID 145345564
molecular hydrogen;2-[(2-oxoazocane-1-carbonyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 145345564) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is molecular hydrogen;2-[(2-oxoazocane-1-carbonyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | molecular hydrogen;2-[(2-oxoazocane-1-carbonyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145345564 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | molecular hydrogen;2-[(2-oxoazocane-1-carbonyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)N1CCCCCCC1=O.[H][H] |
| InChI | InChI=1S/C14H22N2O4.H2/c1-11(2)13(18)20-10-8-15-14(19)16-9-6-4-3-5-7-12(16)17;/h1,3-10H2,2H3,(H,15,19);1H |
| InChIKey | CUFKKXKTYFZWSP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|