About 1-acetylazepan-2-one;methane
1-acetylazepan-2-one;methane (PubChem CID 158348937) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-acetylazepan-2-one;methane.
Molecular Properties
| Compound Name | 1-acetylazepan-2-one;methane |
| PubChem CID | 158348937 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-acetylazepan-2-one;methane |
| SMILES | C.CC(=O)N1CCCCCC1=O |
| InChI | InChI=1S/C8H13NO2.CH4/c1-7(10)9-6-4-2-3-5-8(9)11;/h2-6H2,1H3;1H4 |
| InChIKey | GSBQVRDRTSEWEB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-acetylazepan-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetylazepan-2-one;methane?
The IUPAC name of 1-acetylazepan-2-one;methane (CID 158348937) is 1-acetylazepan-2-one;methane.
What is the SMILES notation for 1-acetylazepan-2-one;methane?
The canonical SMILES for 1-acetylazepan-2-one;methane is C.CC(=O)N1CCCCCC1=O.
What is the InChIKey of 1-acetylazepan-2-one;methane?
The InChIKey is GSBQVRDRTSEWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.CH4/c1-7(10)9-6-4-2-3-5-8(9)11;/h2-6H2,1H3;1H4.
What are the key properties of 1-acetylazepan-2-one;methane?
1-acetylazepan-2-one;methane has a molecular weight of 171.24 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetylazepan-2-one;methane is sourced from PubChem (CID 158348937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).