C8H11NO4 — CID 10932126
2-hydroxy-1-(2-oxopyrrolidin-1-yl)butane-1,3-dione (PubChem CID 10932126) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-hydroxy-1-(2-oxopyrrolidin-1-yl)butane-1,3-dione.
| Compound Name | 2-hydroxy-1-(2-oxopyrrolidin-1-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 10932126 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-hydroxy-1-(2-oxopyrrolidin-1-yl)butane-1,3-dione |
| SMILES | CC(=O)C(O)C(=O)N1CCCC1=O |
| InChI | InChI=1S/C8H11NO4/c1-5(10)7(12)8(13)9-4-2-3-6(9)11/h7,12H,2-4H2,1H3 |
| InChIKey | FXTPJROSGDPHGF-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|