About 2-oxopyrrolidine-1-carboxylic acid;zinc
2-oxopyrrolidine-1-carboxylic acid;zinc (PubChem CID 174972169) has the molecular formula C5H7NO3Zn2
and a molecular weight of 259.89 g/mol. Its IUPAC name is 2-oxopyrrolidine-1-carboxylic acid;zinc.
Molecular Properties
| Compound Name | 2-oxopyrrolidine-1-carboxylic acid;zinc |
| PubChem CID | 174972169 |
| Molecular Formula | C5H7NO3Zn2 |
| Molecular Weight | 259.89 g/mol |
| Exact Mass | 256.90 |
| IUPAC Name | 2-oxopyrrolidine-1-carboxylic acid;zinc |
| SMILES | O=C(O)N1CCCC1=O.[Zn].[Zn] |
| InChI | InChI=1S/C5H7NO3.2Zn/c7-4-2-1-3-6(4)5(8)9;;/h1-3H2,(H,8,9);; |
| InChIKey | JOUCYEGYCFFBEY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.89 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopyrrolidine-1-carboxylic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopyrrolidine-1-carboxylic acid;zinc?
The IUPAC name of 2-oxopyrrolidine-1-carboxylic acid;zinc (CID 174972169) is 2-oxopyrrolidine-1-carboxylic acid;zinc.
What is the SMILES notation for 2-oxopyrrolidine-1-carboxylic acid;zinc?
The canonical SMILES for 2-oxopyrrolidine-1-carboxylic acid;zinc is O=C(O)N1CCCC1=O.[Zn].[Zn].
What is the InChIKey of 2-oxopyrrolidine-1-carboxylic acid;zinc?
The InChIKey is JOUCYEGYCFFBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3.2Zn/c7-4-2-1-3-6(4)5(8)9;;/h1-3H2,(H,8,9);;.
What are the key properties of 2-oxopyrrolidine-1-carboxylic acid;zinc?
2-oxopyrrolidine-1-carboxylic acid;zinc has a molecular weight of 259.89 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopyrrolidine-1-carboxylic acid;zinc is sourced from PubChem (CID 174972169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).