About sodium;2-oxopyrrolidine-1-carboxylate;hydrate
sodium;2-oxopyrrolidine-1-carboxylate;hydrate (PubChem CID 139621831) has the molecular formula C5H8NNaO4
and a molecular weight of 169.11 g/mol. Its IUPAC name is sodium;2-oxopyrrolidine-1-carboxylate;hydrate.
Molecular Properties
| Compound Name | sodium;2-oxopyrrolidine-1-carboxylate;hydrate |
| PubChem CID | 139621831 |
| Molecular Formula | C5H8NNaO4 |
| Molecular Weight | 169.11 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | sodium;2-oxopyrrolidine-1-carboxylate;hydrate |
| SMILES | O.O=C([O-])N1CCCC1=O.[Na+] |
| InChI | InChI=1S/C5H7NO3.Na.H2O/c7-4-2-1-3-6(4)5(8)9;;/h1-3H2,(H,8,9);;1H2/q;+1;/p-1 |
| InChIKey | ICRSJIWAEOUPIV-UHFFFAOYSA-M |
| XLogP | -4.87 |
| TPSA | 91.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.11 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;2-oxopyrrolidine-1-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-oxopyrrolidine-1-carboxylate;hydrate?
The IUPAC name of sodium;2-oxopyrrolidine-1-carboxylate;hydrate (CID 139621831) is sodium;2-oxopyrrolidine-1-carboxylate;hydrate.
What is the SMILES notation for sodium;2-oxopyrrolidine-1-carboxylate;hydrate?
The canonical SMILES for sodium;2-oxopyrrolidine-1-carboxylate;hydrate is O.O=C([O-])N1CCCC1=O.[Na+].
What is the InChIKey of sodium;2-oxopyrrolidine-1-carboxylate;hydrate?
The InChIKey is ICRSJIWAEOUPIV-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H7NO3.Na.H2O/c7-4-2-1-3-6(4)5(8)9;;/h1-3H2,(H,8,9);;1H2/q;+1;/p-1.
What are the key properties of sodium;2-oxopyrrolidine-1-carboxylate;hydrate?
sodium;2-oxopyrrolidine-1-carboxylate;hydrate has a molecular weight of 169.11 g/mol, XLogP of -4.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-oxopyrrolidine-1-carboxylate;hydrate is sourced from PubChem (CID 139621831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).