C7H7Cl3N2O2 — CID 2776871
2-oxo-N-(1,2,2-trichloroethenyl)pyrrolidine-1-carboxamide (PubChem CID 2776871) has the molecular formula C7H7Cl3N2O2 and a molecular weight of 257.50 g/mol. Its IUPAC name is 2-oxo-N-(1,2,2-trichloroethenyl)pyrrolidine-1-carboxamide.
| Compound Name | 2-oxo-N-(1,2,2-trichloroethenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 2776871 |
| Molecular Formula | C7H7Cl3N2O2 |
| Molecular Weight | 257.50 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | 2-oxo-N-(1,2,2-trichloroethenyl)pyrrolidine-1-carboxamide |
| SMILES | O=C1CCCN1C(=O)NC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C7H7Cl3N2O2/c8-5(9)6(10)11-7(14)12-3-1-2-4(12)13/h1-3H2,(H,11,14) |
| InChIKey | GNAOFRDIFCBAHZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|