About 2-oxopyrrolidine-1-carboxylic acid;urea
2-oxopyrrolidine-1-carboxylic acid;urea (PubChem CID 158320427) has the molecular formula C6H11N3O4
and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-oxopyrrolidine-1-carboxylic acid;urea.
Molecular Properties
| Compound Name | 2-oxopyrrolidine-1-carboxylic acid;urea |
| PubChem CID | 158320427 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-oxopyrrolidine-1-carboxylic acid;urea |
| SMILES | NC(N)=O.O=C(O)N1CCCC1=O |
| InChI | InChI=1S/C5H7NO3.CH4N2O/c7-4-2-1-3-6(4)5(8)9;2-1(3)4/h1-3H2,(H,8,9);(H4,2,3,4) |
| InChIKey | GOTXEIPUKWSBDJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxopyrrolidine-1-carboxylic acid;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopyrrolidine-1-carboxylic acid;urea?
The IUPAC name of 2-oxopyrrolidine-1-carboxylic acid;urea (CID 158320427) is 2-oxopyrrolidine-1-carboxylic acid;urea.
What is the SMILES notation for 2-oxopyrrolidine-1-carboxylic acid;urea?
The canonical SMILES for 2-oxopyrrolidine-1-carboxylic acid;urea is NC(N)=O.O=C(O)N1CCCC1=O.
What is the InChIKey of 2-oxopyrrolidine-1-carboxylic acid;urea?
The InChIKey is GOTXEIPUKWSBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3.CH4N2O/c7-4-2-1-3-6(4)5(8)9;2-1(3)4/h1-3H2,(H,8,9);(H4,2,3,4).
What are the key properties of 2-oxopyrrolidine-1-carboxylic acid;urea?
2-oxopyrrolidine-1-carboxylic acid;urea has a molecular weight of 189.17 g/mol, XLogP of -0.69, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopyrrolidine-1-carboxylic acid;urea is sourced from PubChem (CID 158320427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).