About 1-methylpyrrolidin-2-one;urea
1-methylpyrrolidin-2-one;urea (PubChem CID 141281161) has the molecular formula C6H13N3O2
and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;urea.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;urea |
| PubChem CID | 141281161 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1-methylpyrrolidin-2-one;urea |
| SMILES | CN1CCCC1=O.NC(N)=O |
| InChI | InChI=1S/C5H9NO.CH4N2O/c1-6-4-2-3-5(6)7;2-1(3)4/h2-4H2,1H3;(H4,2,3,4) |
| InChIKey | MILNSKQUDUFDQP-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpyrrolidin-2-one;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;urea?
The IUPAC name of 1-methylpyrrolidin-2-one;urea (CID 141281161) is 1-methylpyrrolidin-2-one;urea.
What is the SMILES notation for 1-methylpyrrolidin-2-one;urea?
The canonical SMILES for 1-methylpyrrolidin-2-one;urea is CN1CCCC1=O.NC(N)=O.
What is the InChIKey of 1-methylpyrrolidin-2-one;urea?
The InChIKey is MILNSKQUDUFDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.CH4N2O/c1-6-4-2-3-5(6)7;2-1(3)4/h2-4H2,1H3;(H4,2,3,4).
What are the key properties of 1-methylpyrrolidin-2-one;urea?
1-methylpyrrolidin-2-one;urea has a molecular weight of 159.19 g/mol, XLogP of -0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;urea is sourced from PubChem (CID 141281161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).