About methanethiol;1-methylpyrrolidin-2-one
methanethiol;1-methylpyrrolidin-2-one (PubChem CID 174894965) has the molecular formula C6H13NOS
and a molecular weight of 147.24 g/mol. Its IUPAC name is methanethiol;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | methanethiol;1-methylpyrrolidin-2-one |
| PubChem CID | 174894965 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | methanethiol;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.CS |
| InChI | InChI=1S/C5H9NO.CH4S/c1-6-4-2-3-5(6)7;1-2/h2-4H2,1H3;2H,1H3 |
| InChIKey | IZWVXDNMSPRAOB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;1-methylpyrrolidin-2-one?
The IUPAC name of methanethiol;1-methylpyrrolidin-2-one (CID 174894965) is methanethiol;1-methylpyrrolidin-2-one.
What is the SMILES notation for methanethiol;1-methylpyrrolidin-2-one?
The canonical SMILES for methanethiol;1-methylpyrrolidin-2-one is CN1CCCC1=O.CS.
What is the InChIKey of methanethiol;1-methylpyrrolidin-2-one?
The InChIKey is IZWVXDNMSPRAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.CH4S/c1-6-4-2-3-5(6)7;1-2/h2-4H2,1H3;2H,1H3.
What are the key properties of methanethiol;1-methylpyrrolidin-2-one?
methanethiol;1-methylpyrrolidin-2-one has a molecular weight of 147.24 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;1-methylpyrrolidin-2-one is sourced from PubChem (CID 174894965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).