About 1-methylpyrrolidin-2-one;nickel(2+);dinitrate
1-methylpyrrolidin-2-one;nickel(2+);dinitrate (PubChem CID 175425865) has the molecular formula C5H9N3NiO7
and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;nickel(2+);dinitrate.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;nickel(2+);dinitrate |
| PubChem CID | 175425865 |
| Molecular Formula | C5H9N3NiO7 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 1-methylpyrrolidin-2-one;nickel(2+);dinitrate |
| SMILES | CN1CCCC1=O.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Ni+2] |
| InChI | InChI=1S/C5H9NO.2NO3.Ni/c1-6-4-2-3-5(6)7;2*2-1(3)4;/h2-4H2,1H3;;;/q;2*-1;+2 |
| InChIKey | MDJPUPLDJZSOIQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 152.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolidin-2-one;nickel(2+);dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;nickel(2+);dinitrate?
The IUPAC name of 1-methylpyrrolidin-2-one;nickel(2+);dinitrate (CID 175425865) is 1-methylpyrrolidin-2-one;nickel(2+);dinitrate.
What is the SMILES notation for 1-methylpyrrolidin-2-one;nickel(2+);dinitrate?
The canonical SMILES for 1-methylpyrrolidin-2-one;nickel(2+);dinitrate is CN1CCCC1=O.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Ni+2].
What is the InChIKey of 1-methylpyrrolidin-2-one;nickel(2+);dinitrate?
The InChIKey is MDJPUPLDJZSOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.2NO3.Ni/c1-6-4-2-3-5(6)7;2*2-1(3)4;/h2-4H2,1H3;;;/q;2*-1;+2.
What are the key properties of 1-methylpyrrolidin-2-one;nickel(2+);dinitrate?
1-methylpyrrolidin-2-one;nickel(2+);dinitrate has a molecular weight of 281.83 g/mol, XLogP of -0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;nickel(2+);dinitrate is sourced from PubChem (CID 175425865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).