C7H17N3O — CID 158124150
ethane-1,2-diamine;1-methylpyrrolidin-2-one (PubChem CID 158124150) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is ethane-1,2-diamine;1-methylpyrrolidin-2-one.
| Compound Name | ethane-1,2-diamine;1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 158124150 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | ethane-1,2-diamine;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.NCCN |
| InChI | InChI=1S/C5H9NO.C2H8N2/c1-6-4-2-3-5(6)7;3-1-2-4/h2-4H2,1H3;1-4H2 |
| InChIKey | FRYLZXILHPFZRF-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |