About 1-methylpyrrolidin-2-one;oxetane
1-methylpyrrolidin-2-one;oxetane (PubChem CID 170438379) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;oxetane.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;oxetane |
| PubChem CID | 170438379 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 1-methylpyrrolidin-2-one;oxetane |
| SMILES | C1COC1.CN1CCCC1=O |
| InChI | InChI=1S/C5H9NO.C3H6O/c1-6-4-2-3-5(6)7;1-2-4-3-1/h2-4H2,1H3;1-3H2 |
| InChIKey | DXMDDCSMMOSBNE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpyrrolidin-2-one;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;oxetane?
The IUPAC name of 1-methylpyrrolidin-2-one;oxetane (CID 170438379) is 1-methylpyrrolidin-2-one;oxetane.
What is the SMILES notation for 1-methylpyrrolidin-2-one;oxetane?
The canonical SMILES for 1-methylpyrrolidin-2-one;oxetane is C1COC1.CN1CCCC1=O.
What is the InChIKey of 1-methylpyrrolidin-2-one;oxetane?
The InChIKey is DXMDDCSMMOSBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C3H6O/c1-6-4-2-3-5(6)7;1-2-4-3-1/h2-4H2,1H3;1-3H2.
What are the key properties of 1-methylpyrrolidin-2-one;oxetane?
1-methylpyrrolidin-2-one;oxetane has a molecular weight of 157.21 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;oxetane is sourced from PubChem (CID 170438379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).