C20H32N2O4 — CID 19994069
1,8-bis(2-oxoazepan-1-yl)octane-1,8-dione (PubChem CID 19994069) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1,8-bis(2-oxoazepan-1-yl)octane-1,8-dione.
| Compound Name | 1,8-bis(2-oxoazepan-1-yl)octane-1,8-dione |
|---|---|
| PubChem CID | 19994069 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1,8-bis(2-oxoazepan-1-yl)octane-1,8-dione |
| SMILES | O=C(CCCCCCC(=O)N1CCCCCC1=O)N1CCCCCC1=O |
| InChI | InChI=1S/C20H32N2O4/c23-17(21-15-9-3-7-13-19(21)25)11-5-1-2-6-12-18(24)22-16-10-4-8-14-20(22)26/h1-16H2 |
| InChIKey | SSVCFFOZXBCCDM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|