C15H19NO2 — CID 101320219
1-(3,3-dideuterio-4-phenylbutanoyl)piperidin-2-one (PubChem CID 101320219) has the molecular formula C15H19NO2 and a molecular weight of 247.33 g/mol. Its IUPAC name is 1-(3,3-dideuterio-4-phenylbutanoyl)piperidin-2-one.
| Compound Name | 1-(3,3-dideuterio-4-phenylbutanoyl)piperidin-2-one |
|---|---|
| PubChem CID | 101320219 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 1-(3,3-dideuterio-4-phenylbutanoyl)piperidin-2-one |
| SMILES | [2H]C([2H])(CC(=O)N1CCCCC1=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c17-14-10-4-5-12-16(14)15(18)11-6-9-13-7-2-1-3-8-13/h1-3,7-8H,4-6,9-12H2/i6D2 |
| InChIKey | VWMYFCUYOIXABI-NCYHJHSESA-N |
| XLogP | 2.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |