C17H23NO2 — CID 102595226
1-(2,2-dideuterio-5-phenylpentanoyl)azepan-2-one (PubChem CID 102595226) has the molecular formula C17H23NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-(2,2-dideuterio-5-phenylpentanoyl)azepan-2-one.
| Compound Name | 1-(2,2-dideuterio-5-phenylpentanoyl)azepan-2-one |
|---|---|
| PubChem CID | 102595226 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-(2,2-dideuterio-5-phenylpentanoyl)azepan-2-one |
| SMILES | [2H]C([2H])(CCCc1ccccc1)C(=O)N1CCCCCC1=O |
| InChI | InChI=1S/C17H23NO2/c19-16-12-5-2-8-14-18(16)17(20)13-7-6-11-15-9-3-1-4-10-15/h1,3-4,9-10H,2,5-8,11-14H2/i13D2 |
| InChIKey | YQLFKMPWYVEEHB-KLTYLHELSA-N |
| XLogP | 3.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |