C21H37N3O4S — CID 130316643
10-amino-1-[[3-oxo-3-(2-oxoazepan-1-yl)propyl]-(2-sulfanylethyl)amino]decane-3,5-dione (PubChem CID 130316643) has the molecular formula C21H37N3O4S and a molecular weight of 427.61 g/mol. Its IUPAC name is 10-amino-1-[[3-oxo-3-(2-oxoazepan-1-yl)propyl]-(2-sulfanylethyl)amino]decane-3,5-dione.
| Compound Name | 10-amino-1-[[3-oxo-3-(2-oxoazepan-1-yl)propyl]-(2-sulfanylethyl)amino]decane-3,5-dione |
|---|---|
| PubChem CID | 130316643 |
| Molecular Formula | C21H37N3O4S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 10-amino-1-[[3-oxo-3-(2-oxoazepan-1-yl)propyl]-(2-sulfanylethyl)amino]decane-3,5-dione |
| SMILES | NCCCCCC(=O)CC(=O)CCN(CCS)CCC(=O)N1CCCCCC1=O |
| InChI | InChI=1S/C21H37N3O4S/c22-11-5-1-3-7-18(25)17-19(26)9-13-23(15-16-29)14-10-21(28)24-12-6-2-4-8-20(24)27/h29H,1-17,22H2 |
| InChIKey | QMBLUVANOIKBPW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|