C23H38N4O4 — CID 89256551
2-[3-[[1-amino-2,2,3,3-tetramethyl-4-(2-oxopyrrolidin-1-yl)hex-4-enylidene]amino]propanoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 89256551) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[3-[[1-amino-2,2,3,3-tetramethyl-4-(2-oxopyrrolidin-1-yl)hex-4-enylidene]amino]propanoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[[1-amino-2,2,3,3-tetramethyl-4-(2-oxopyrrolidin-1-yl)hex-4-enylidene]amino]propanoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89256551 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 2-[3-[[1-amino-2,2,3,3-tetramethyl-4-(2-oxopyrrolidin-1-yl)hex-4-enylidene]amino]propanoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)CC/N=C(\N)C(C)(C)C(C)(C)C(=CC)N1CCCC1=O |
| InChI | InChI=1S/C23H38N4O4/c1-8-17(27-14-9-10-19(27)29)22(4,5)23(6,7)21(24)26-12-11-18(28)25-13-15-31-20(30)16(2)3/h8H,2,9-15H2,1,3-7H3,(H2,24,26)(H,25,28) |
| InChIKey | AWDGDYQOSLYVKJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|