C14H23NO4S — CID 121300694
2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 121300694) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121300694 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)SCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H23NO4S/c1-10(2)12(17)19-8-7-15-13(18)20-9-6-11(16)14(3,4)5/h1,6-9H2,2-5H3,(H,15,18) |
| InChIKey | ZMZIAEYPEORGOG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|