C19H29NO7S2 — CID 161353590
[4-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylsulfanyl]ethoxy]ethylsulfanyl]-4-oxobutyl] 2-methylprop-2-enoate (PubChem CID 161353590) has the molecular formula C19H29NO7S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is [4-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylsulfanyl]ethoxy]ethylsulfanyl]-4-oxobutyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylsulfanyl]ethoxy]ethylsulfanyl]-4-oxobutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161353590 |
| Molecular Formula | C19H29NO7S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [4-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylsulfanyl]ethoxy]ethylsulfanyl]-4-oxobutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)SCCOCCSC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C19H29NO7S2/c1-14(2)17(22)26-8-5-6-16(21)28-12-10-25-11-13-29-19(24)20-7-9-27-18(23)15(3)4/h1,3,5-13H2,2,4H3,(H,20,24) |
| InChIKey | IVVHNWZPOOFZQY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|