C22H28N2O6S2 — CID 89394531
2-[2-[4-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylsulfanylcarbonylamino]anilino]acetyl]sulfanylethyl 2-methylprop-2-enoate (PubChem CID 89394531) has the molecular formula C22H28N2O6S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[2-[4-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylsulfanylcarbonylamino]anilino]acetyl]sulfanylethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylsulfanylcarbonylamino]anilino]acetyl]sulfanylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89394531 |
| Molecular Formula | C22H28N2O6S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[2-[4-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylsulfanylcarbonylamino]anilino]acetyl]sulfanylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCSC(=O)CNc1ccc(C)c(NC(=O)SCCOC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C22H28N2O6S2/c1-14(2)20(26)29-8-10-31-19(25)13-23-17-7-6-16(5)18(12-17)24-22(28)32-11-9-30-21(27)15(3)4/h6-7,12,23H,1,3,8-11,13H2,2,4-5H3,(H,24,28) |
| InChIKey | XQYXQKCQFYKGPH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|