C35H38N2O10 — CID 89215935
[2-[[4-methyl-3-[[1-(2-methylprop-2-enoyloxy)-3-phenoxypropan-2-yl]oxycarbonylamino]phenyl]carbamoyloxy]-3-phenoxypropyl] 2-methylprop-2-enoate (PubChem CID 89215935) has the molecular formula C35H38N2O10 and a molecular weight of 646.69 g/mol. Its IUPAC name is [2-[[4-methyl-3-[[1-(2-methylprop-2-enoyloxy)-3-phenoxypropan-2-yl]oxycarbonylamino]phenyl]carbamoyloxy]-3-phenoxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-methyl-3-[[1-(2-methylprop-2-enoyloxy)-3-phenoxypropan-2-yl]oxycarbonylamino]phenyl]carbamoyloxy]-3-phenoxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89215935 |
| Molecular Formula | C35H38N2O10 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | [2-[[4-methyl-3-[[1-(2-methylprop-2-enoyloxy)-3-phenoxypropan-2-yl]oxycarbonylamino]phenyl]carbamoyloxy]-3-phenoxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COc1ccccc1)OC(=O)Nc1ccc(C)c(NC(=O)OC(COC(=O)C(=C)C)COc2ccccc2)c1 |
| InChI | InChI=1S/C35H38N2O10/c1-23(2)32(38)44-21-29(19-42-27-12-8-6-9-13-27)46-34(40)36-26-17-16-25(5)31(18-26)37-35(41)47-30(22-45-33(39)24(3)4)20-43-28-14-10-7-11-15-28/h6-18,29-30H,1,3,19-22H2,2,4-5H3,(H,36,40)(H,37,41) |
| InChIKey | YKHNYIYAWPULHU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|