C38H46O13 — CID 157171228
[1-[3-[3-(2-methylprop-2-enoyloxy)-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propoxy]phenoxy]-3-phenoxypropan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 157171228) has the molecular formula C38H46O13 and a molecular weight of 710.77 g/mol. Its IUPAC name is [1-[3-[3-(2-methylprop-2-enoyloxy)-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propoxy]phenoxy]-3-phenoxypropan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | [1-[3-[3-(2-methylprop-2-enoyloxy)-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propoxy]phenoxy]-3-phenoxypropan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 157171228 |
| Molecular Formula | C38H46O13 |
| Molecular Weight | 710.77 g/mol |
| Exact Mass | 710.29 |
| IUPAC Name | [1-[3-[3-(2-methylprop-2-enoyloxy)-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propoxy]phenoxy]-3-phenoxypropan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)OC(COC(=O)C(=C)C)COc1cccc(OCC(COc2ccccc2)OC(=O)CCCOC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C38H46O13/c1-26(2)36(41)44-19-11-17-34(39)50-32(22-46-29-13-8-7-9-14-29)23-47-30-15-10-16-31(21-30)48-24-33(25-49-38(43)28(5)6)51-35(40)18-12-20-45-37(42)27(3)4/h7-10,13-16,21,32-33H,1,3,5,11-12,17-20,22-25H2,2,4,6H3 |
| InChIKey | ANMIJTZNACCUGL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.77 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|