C26H31ClO5S — CID 158968959
[1-(4-chlorophenyl)sulfanyl-3-(4-propan-2-ylphenoxy)propan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 158968959) has the molecular formula C26H31ClO5S and a molecular weight of 491.05 g/mol. Its IUPAC name is [1-(4-chlorophenyl)sulfanyl-3-(4-propan-2-ylphenoxy)propan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | [1-(4-chlorophenyl)sulfanyl-3-(4-propan-2-ylphenoxy)propan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 158968959 |
| Molecular Formula | C26H31ClO5S |
| Molecular Weight | 491.05 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [1-(4-chlorophenyl)sulfanyl-3-(4-propan-2-ylphenoxy)propan-2-yl] 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)OC(COc1ccc(C(C)C)cc1)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H31ClO5S/c1-18(2)20-7-11-22(12-8-20)31-16-23(17-33-24-13-9-21(27)10-14-24)32-25(28)6-5-15-30-26(29)19(3)4/h7-14,18,23H,3,5-6,15-17H2,1-2,4H3 |
| InChIKey | SJDSIVUWGAGUSZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.05 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|