C21H27ClO2S — CID 155280028
1-chloro-4-[2-propan-2-yloxy-3-(4-propan-2-ylphenoxy)propyl]sulfanylbenzene (PubChem CID 155280028) has the molecular formula C21H27ClO2S and a molecular weight of 378.97 g/mol. Its IUPAC name is 1-chloro-4-[2-propan-2-yloxy-3-(4-propan-2-ylphenoxy)propyl]sulfanylbenzene.
| Compound Name | 1-chloro-4-[2-propan-2-yloxy-3-(4-propan-2-ylphenoxy)propyl]sulfanylbenzene |
|---|---|
| PubChem CID | 155280028 |
| Molecular Formula | C21H27ClO2S |
| Molecular Weight | 378.97 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-chloro-4-[2-propan-2-yloxy-3-(4-propan-2-ylphenoxy)propyl]sulfanylbenzene |
| SMILES | CC(C)OC(COc1ccc(C(C)C)cc1)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClO2S/c1-15(2)17-5-9-19(10-6-17)23-13-20(24-16(3)4)14-25-21-11-7-18(22)8-12-21/h5-12,15-16,20H,13-14H2,1-4H3 |
| InChIKey | RIGHOPFKTXXLSK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |