C29H27Cl2NO2 — CID 90397573
N,N-bis(4-chlorophenyl)-4-[2-(4-propan-2-ylphenoxy)ethoxy]aniline (PubChem CID 90397573) has the molecular formula C29H27Cl2NO2 and a molecular weight of 492.45 g/mol. Its IUPAC name is N,N-bis(4-chlorophenyl)-4-[2-(4-propan-2-ylphenoxy)ethoxy]aniline.
| Compound Name | N,N-bis(4-chlorophenyl)-4-[2-(4-propan-2-ylphenoxy)ethoxy]aniline |
|---|---|
| PubChem CID | 90397573 |
| Molecular Formula | C29H27Cl2NO2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | N,N-bis(4-chlorophenyl)-4-[2-(4-propan-2-ylphenoxy)ethoxy]aniline |
| SMILES | CC(C)c1ccc(OCCOc2ccc(N(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H27Cl2NO2/c1-21(2)22-3-15-28(16-4-22)33-19-20-34-29-17-13-27(14-18-29)32(25-9-5-23(30)6-10-25)26-11-7-24(31)8-12-26/h3-18,21H,19-20H2,1-2H3 |
| InChIKey | DYXOZNKKJCBKIJ-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|