C12H19NO — CID 59918748
N,N-dimethyl-1-(4-propan-2-ylphenoxy)methanamine (PubChem CID 59918748) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-propan-2-ylphenoxy)methanamine.
| Compound Name | N,N-dimethyl-1-(4-propan-2-ylphenoxy)methanamine |
|---|---|
| PubChem CID | 59918748 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N,N-dimethyl-1-(4-propan-2-ylphenoxy)methanamine |
| SMILES | CC(C)c1ccc(OCN(C)C)cc1 |
| InChI | InChI=1S/C12H19NO/c1-10(2)11-5-7-12(8-6-11)14-9-13(3)4/h5-8,10H,9H2,1-4H3 |
| InChIKey | JDHATRJSPZSAGG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|