C23H28ClNO5S — CID 163492135
2-[[1-(4-chlorophenyl)sulfanyl-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 163492135) has the molecular formula C23H28ClNO5S and a molecular weight of 466.00 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)sulfanyl-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[1-(4-chlorophenyl)sulfanyl-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163492135 |
| Molecular Formula | C23H28ClNO5S |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)sulfanyl-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC(COC1=CC(C)CC=C1)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClNO5S/c1-16(2)22(26)28-12-11-25-23(27)30-20(14-29-19-6-4-5-17(3)13-19)15-31-21-9-7-18(24)8-10-21/h4,6-10,13,17,20H,1,5,11-12,14-15H2,2-3H3,(H,25,27) |
| InChIKey | CNOIDRAYZULDOB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|