C13H21F2NO6 — CID 88857837
2-[[1-(2-fluoroethoxy)-3-(fluoromethoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 88857837) has the molecular formula C13H21F2NO6 and a molecular weight of 325.31 g/mol. Its IUPAC name is 2-[[1-(2-fluoroethoxy)-3-(fluoromethoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[1-(2-fluoroethoxy)-3-(fluoromethoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88857837 |
| Molecular Formula | C13H21F2NO6 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[[1-(2-fluoroethoxy)-3-(fluoromethoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC(COCF)COCCF |
| InChI | InChI=1S/C13H21F2NO6/c1-10(2)12(17)21-6-4-16-13(18)22-11(8-20-9-15)7-19-5-3-14/h11H,1,3-9H2,2H3,(H,16,18) |
| InChIKey | YZFJLIFZNUWQQG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|