C18H24O6 — CID 159802316
(1-ethoxy-3-phenoxypropan-2-yl) 4-prop-2-enoyloxybutanoate (PubChem CID 159802316) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is (1-ethoxy-3-phenoxypropan-2-yl) 4-prop-2-enoyloxybutanoate.
| Compound Name | (1-ethoxy-3-phenoxypropan-2-yl) 4-prop-2-enoyloxybutanoate |
|---|---|
| PubChem CID | 159802316 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (1-ethoxy-3-phenoxypropan-2-yl) 4-prop-2-enoyloxybutanoate |
| SMILES | C=CC(=O)OCCCC(=O)OC(COCC)COc1ccccc1 |
| InChI | InChI=1S/C18H24O6/c1-3-17(19)22-12-8-11-18(20)24-16(13-21-4-2)14-23-15-9-6-5-7-10-15/h3,5-7,9-10,16H,1,4,8,11-14H2,2H3 |
| InChIKey | LJQKUMALPNJMEI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|