C18H22O8 — CID 20588159
4-oxo-4-[2-phenoxy-3-(2-prop-2-enoyloxyethoxy)propoxy]butanoic acid (PubChem CID 20588159) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is 4-oxo-4-[2-phenoxy-3-(2-prop-2-enoyloxyethoxy)propoxy]butanoic acid.
| Compound Name | 4-oxo-4-[2-phenoxy-3-(2-prop-2-enoyloxyethoxy)propoxy]butanoic acid |
|---|---|
| PubChem CID | 20588159 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-oxo-4-[2-phenoxy-3-(2-prop-2-enoyloxyethoxy)propoxy]butanoic acid |
| SMILES | C=CC(=O)OCCOCC(COC(=O)CCC(=O)O)Oc1ccccc1 |
| InChI | InChI=1S/C18H22O8/c1-2-17(21)24-11-10-23-12-15(26-14-6-4-3-5-7-14)13-25-18(22)9-8-16(19)20/h2-7,15H,1,8-13H2,(H,19,20) |
| InChIKey | FUWPFVPZEYRQFX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|