C18H23NO6 — CID 89196005
[3-(1-hydroxy-2-methylprop-2-enoxy)-2-(phenylcarbamoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 89196005) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [3-(1-hydroxy-2-methylprop-2-enoxy)-2-(phenylcarbamoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [3-(1-hydroxy-2-methylprop-2-enoxy)-2-(phenylcarbamoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89196005 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [3-(1-hydroxy-2-methylprop-2-enoxy)-2-(phenylcarbamoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(O)C(=C)C)OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H23NO6/c1-12(2)16(20)23-10-15(11-24-17(21)13(3)4)25-18(22)19-14-8-6-5-7-9-14/h5-9,15-16,20H,1,3,10-11H2,2,4H3,(H,19,22) |
| InChIKey | RECFOZXCVFXVPM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|