C26H27N3O6 — CID 20688817
3,5-bis(phenylcarbamoyloxy)pentyl N-phenylcarbamate (PubChem CID 20688817) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is 3,5-bis(phenylcarbamoyloxy)pentyl N-phenylcarbamate.
| Compound Name | 3,5-bis(phenylcarbamoyloxy)pentyl N-phenylcarbamate |
|---|---|
| PubChem CID | 20688817 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3,5-bis(phenylcarbamoyloxy)pentyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCC(CCOC(=O)Nc1ccccc1)OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H27N3O6/c30-24(27-20-10-4-1-5-11-20)33-18-16-23(35-26(32)29-22-14-8-3-9-15-22)17-19-34-25(31)28-21-12-6-2-7-13-21/h1-15,23H,16-19H2,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | KJYZQDCFNCYQLQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|