About 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate
2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate (PubChem CID 58663822) has the molecular formula C16H16N2O3S
and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate |
| PubChem CID | 58663822 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCSC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H16N2O3S/c19-15(17-13-7-3-1-4-8-13)21-11-12-22-16(20)18-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20) |
| InChIKey | SYHXBNQOOZRMRY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate?
The IUPAC name of 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate (CID 58663822) is 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate.
What is the SMILES notation for 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate?
The canonical SMILES for 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate is O=C(Nc1ccccc1)OCCSC(=O)Nc1ccccc1.
What is the InChIKey of 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate?
The InChIKey is SYHXBNQOOZRMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3S/c19-15(17-13-7-3-1-4-8-13)21-11-12-22-16(20)18-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20).
What are the key properties of 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate?
2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate has a molecular weight of 316.38 g/mol, XLogP of 4.20, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenylcarbamoylsulfanyl)ethyl N-phenylcarbamate is sourced from PubChem (CID 58663822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).