About 2-(benzenesulfonyl)ethyl N-phenylcarbamate
2-(benzenesulfonyl)ethyl N-phenylcarbamate (PubChem CID 14081594) has the molecular formula C15H15NO4S
and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(benzenesulfonyl)ethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)ethyl N-phenylcarbamate |
| PubChem CID | 14081594 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-(benzenesulfonyl)ethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15NO4S/c17-15(16-13-7-3-1-4-8-13)20-11-12-21(18,19)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,17) |
| InChIKey | XQUPPQFTIPSYQF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzenesulfonyl)ethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)ethyl N-phenylcarbamate?
The IUPAC name of 2-(benzenesulfonyl)ethyl N-phenylcarbamate (CID 14081594) is 2-(benzenesulfonyl)ethyl N-phenylcarbamate.
What is the SMILES notation for 2-(benzenesulfonyl)ethyl N-phenylcarbamate?
The canonical SMILES for 2-(benzenesulfonyl)ethyl N-phenylcarbamate is O=C(Nc1ccccc1)OCCS(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)ethyl N-phenylcarbamate?
The InChIKey is XQUPPQFTIPSYQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4S/c17-15(16-13-7-3-1-4-8-13)20-11-12-21(18,19)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,17).
What are the key properties of 2-(benzenesulfonyl)ethyl N-phenylcarbamate?
2-(benzenesulfonyl)ethyl N-phenylcarbamate has a molecular weight of 305.36 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)ethyl N-phenylcarbamate is sourced from PubChem (CID 14081594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).