C30H42N2O4 — CID 134983552
[(E)-16-(phenylcarbamoyloxy)hexadec-8-enyl] N-phenylcarbamate (PubChem CID 134983552) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is [(E)-16-(phenylcarbamoyloxy)hexadec-8-enyl] N-phenylcarbamate.
| Compound Name | [(E)-16-(phenylcarbamoyloxy)hexadec-8-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 134983552 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | [(E)-16-(phenylcarbamoyloxy)hexadec-8-enyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCCCCCC/C=C/CCCCCCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H42N2O4/c33-29(31-27-21-15-13-16-22-27)35-25-19-11-9-7-5-3-1-2-4-6-8-10-12-20-26-36-30(34)32-28-23-17-14-18-24-28/h1-2,13-18,21-24H,3-12,19-20,25-26H2,(H,31,33)(H,32,34)/b2-1+ |
| InChIKey | ZRSIQLIYIDTTLX-OWOJBTEDSA-N |
| XLogP | 8.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|