C19H22N2O3 — CID 154035424
[3-(2-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 154035424) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is [3-(2-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154035424 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [3-(2-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CNc1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-14(2)19(23)24-13-16(22)12-20-17-10-6-7-11-18(17)21-15-8-4-3-5-9-15/h3-11,16,20-22H,1,12-13H2,2H3 |
| InChIKey | DODSVJPCMUHAFJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|