C37H44N4O3 — CID 158491321
[3-(4-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate;1-N-cyclohexyl-4-N-phenylbenzene-1,4-diamine (PubChem CID 158491321) has the molecular formula C37H44N4O3 and a molecular weight of 592.78 g/mol. Its IUPAC name is [3-(4-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate;1-N-cyclohexyl-4-N-phenylbenzene-1,4-diamine.
| Compound Name | [3-(4-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate;1-N-cyclohexyl-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 158491321 |
| Molecular Formula | C37H44N4O3 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | [3-(4-anilinoanilino)-2-hydroxypropyl] 2-methylprop-2-enoate;1-N-cyclohexyl-4-N-phenylbenzene-1,4-diamine |
| SMILES | C=C(C)C(=O)OCC(O)CNc1ccc(Nc2ccccc2)cc1.c1ccc(Nc2ccc(NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O3.C18H22N2/c1-14(2)19(23)24-13-18(22)12-20-15-8-10-17(11-9-15)21-16-6-4-3-5-7-16;1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h3-11,18,20-22H,1,12-13H2,2H3;1,3-4,7-8,11-14,16,19-20H,2,5-6,9-10H2 |
| InChIKey | HISPWXZKBVKZOI-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|