C13H19BO6 — CID 174989633
2,3-dihydroxypropyl 2-methylprop-2-enoate;phenylboronic acid (PubChem CID 174989633) has the molecular formula C13H19BO6 and a molecular weight of 282.10 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-methylprop-2-enoate;phenylboronic acid.
| Compound Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;phenylboronic acid |
|---|---|
| PubChem CID | 174989633 |
| Molecular Formula | C13H19BO6 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;phenylboronic acid |
| SMILES | C=C(C)C(=O)OCC(O)CO.OB(O)c1ccccc1 |
| InChI | InChI=1S/C7H12O4.C6H7BO2/c1-5(2)7(10)11-4-6(9)3-8;8-7(9)6-4-2-1-3-5-6/h6,8-9H,1,3-4H2,2H3;1-5,8-9H |
| InChIKey | OYRIRCCSCHXCHG-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|