C25H48O7 — CID 53470723
2,3-dihydroxypropyl 2-methylprop-2-enoate;2-hydroxyoctadecanoic acid (PubChem CID 53470723) has the molecular formula C25H48O7 and a molecular weight of 460.65 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-hydroxyoctadecanoic acid.
| Compound Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-hydroxyoctadecanoic acid |
|---|---|
| PubChem CID | 53470723 |
| Molecular Formula | C25H48O7 |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-hydroxyoctadecanoic acid |
| SMILES | C=C(C)C(=O)OCC(O)CO.CCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C18H36O3.C7H12O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21;1-5(2)7(10)11-4-6(9)3-8/h17,19H,2-16H2,1H3,(H,20,21);6,8-9H,1,3-4H2,2H3 |
| InChIKey | VWDTZCFZPQOQKB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|