C21H44O7 — CID 87746572
3-hydroperoxypropane-1,2-diol;2-hydroxyoctadecanoic acid (PubChem CID 87746572) has the molecular formula C21H44O7 and a molecular weight of 408.58 g/mol. Its IUPAC name is 3-hydroperoxypropane-1,2-diol;2-hydroxyoctadecanoic acid.
| Compound Name | 3-hydroperoxypropane-1,2-diol;2-hydroxyoctadecanoic acid |
|---|---|
| PubChem CID | 87746572 |
| Molecular Formula | C21H44O7 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 3-hydroperoxypropane-1,2-diol;2-hydroxyoctadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCC(O)C(=O)O.OCC(O)COO |
| InChI | InChI=1S/C18H36O3.C3H8O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21;4-1-3(5)2-7-6/h17,19H,2-16H2,1H3,(H,20,21);3-6H,1-2H2 |
| InChIKey | WGPQKCLZAMCSIM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|