C19H26O5S — CID 58455685
[2-hydroxy-3-[3-(2-phenylpropylsulfanyl)propanoyloxy]propyl] 2-methylprop-2-enoate (PubChem CID 58455685) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is [2-hydroxy-3-[3-(2-phenylpropylsulfanyl)propanoyloxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[3-(2-phenylpropylsulfanyl)propanoyloxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58455685 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [2-hydroxy-3-[3-(2-phenylpropylsulfanyl)propanoyloxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CCSCC(C)c1ccccc1 |
| InChI | InChI=1S/C19H26O5S/c1-14(2)19(22)24-12-17(20)11-23-18(21)9-10-25-13-15(3)16-7-5-4-6-8-16/h4-8,15,17,20H,1,9-13H2,2-3H3 |
| InChIKey | VTBMXPWKXIHSPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|