C19H28O5S — CID 122413807
[2-hydroxy-3-(2-phenylpropylsulfanylcarbonyloxy)propyl] 2,2-dimethylbutanoate (PubChem CID 122413807) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is [2-hydroxy-3-(2-phenylpropylsulfanylcarbonyloxy)propyl] 2,2-dimethylbutanoate.
| Compound Name | [2-hydroxy-3-(2-phenylpropylsulfanylcarbonyloxy)propyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 122413807 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [2-hydroxy-3-(2-phenylpropylsulfanylcarbonyloxy)propyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(O)COC(=O)SCC(C)c1ccccc1 |
| InChI | InChI=1S/C19H28O5S/c1-5-19(3,4)17(21)23-11-16(20)12-24-18(22)25-13-14(2)15-9-7-6-8-10-15/h6-10,14,16,20H,5,11-13H2,1-4H3 |
| InChIKey | QKFZMSVUFPDXPK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|