C15H21BrO4 — CID 59017839
[3-(3-bromophenoxy)-2-hydroxypropyl] 2,2-dimethylbutanoate (PubChem CID 59017839) has the molecular formula C15H21BrO4 and a molecular weight of 345.23 g/mol. Its IUPAC name is [3-(3-bromophenoxy)-2-hydroxypropyl] 2,2-dimethylbutanoate.
| Compound Name | [3-(3-bromophenoxy)-2-hydroxypropyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59017839 |
| Molecular Formula | C15H21BrO4 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [3-(3-bromophenoxy)-2-hydroxypropyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C15H21BrO4/c1-4-15(2,3)14(18)20-10-12(17)9-19-13-7-5-6-11(16)8-13/h5-8,12,17H,4,9-10H2,1-3H3 |
| InChIKey | BZOXOEGKGSYBKE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |